| Identification |
| Name: | 2,5,8,10-Tetraoxatridec-12-enoicacid, 9-oxo-, 2-propen-1-yl ester |
| Synonyms: | 2,5,8,10-Tetraoxatridec-12-enoicacid, 9-oxo-, 2-propenyl ester (9CI); Carbonic acid, allyl ester, diester withdiethylene glycol (6CI,7CI); Carbonic acid, oxydiethylene diallyl ester (8CI);01M; Allyl diglycol carbonate; Brite 55; CR 39R; Carbonic acid,oxydi-2,1-ethanediyl di-2-propenyl ester; Diallyl diglycol carbonate; Diallyloxydiethylene dicarbonate; Diethylene glycol diallyl dicarbonate; Diethyleneglycol, bis(allyl carbonate); High ADC-CR 39; Hoya HL; NSC 5246; Nouryset 200;RAV 7; RAV 7AT; RAV 7N; TS 16; Transallyl CR 39 |
| CAS: | 142-22-3 |
| EINECS: | 205-528-7 |
| Molecular Formula: | C12H18 O7 |
| Molecular Weight: | 274.30 |
| InChI: | InChI=1/C12H18O7/c1-3-5-16-11(13)18-9-7-15-8-10-19-12(14)17-6-4-2/h3-4H,1-2,5-10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3237 4.1 |
| Density: | 1.129g/cm3 |
| Stability: | Stability Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | n20/D 1.451(lit.) |
| Appearance: | liquid |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Color: | Liquid |
| Usage: | Monomer for allyl resins, particularly in optically clear castings. |
| Safety Data |
| Hazard Symbols |
Xn: Harmful
|
| |
 |
