| Identification | |
| Name: | Glycine,N-(carboxymethyl)- |
| Synonyms: | Aceticacid, iminodi- (6CI,8CI);((Carboxymethyl)amino)acetic acid;Acetic acid,2,2'-iminobis-;Aminodiacetic acid;Diglycin;Diglycine;IDA;IDA(chelating agent);IMDA;Iminobis(acetic acid);N-(Carboxymethyl)glycine;NSC 18467;a-Iminodiacetic acid; |
| CAS: | 142-73-4 |
| EINECS: | 205-555-4 |
| Molecular Formula: | C4H7NO4 |
| Molecular Weight: | 133.1 |
| InChI: | InChI=1/C4H7NO4/c6-3(7)1-5-2-4(8)9/h5H,1-2H2,(H,6,7)(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.436 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.501 |
| Solubility: | Soluble in water:2.43 g/100 mL (5 oC) |
| Appearance: | White crystal |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29224995 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | ORTHORHOMBIC CRYSTALS |
| Usage: | Has been suggested as intermediate in manufacture of complex salts, chelating agents. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
