Identification |
Name: | 1H-Indole,3-(1-methyl-2-pyrrolidinyl)-5-(phenylmethoxy)- |
Synonyms: | Indole,5-(benzyloxy)-3-(1-methyl-2-pyrrolidinyl)- (7CI,8CI) |
CAS: | 14226-68-7 |
Molecular Formula: | C20H22 N2 O |
Molecular Weight: | 306.44 |
InChI: | InChI=1/C20H22N2O/c1-22-11-5-8-20(22)18-13-21-19-10-9-16(12-17(18)19)23-14-15-6-3-2-4-7-15/h2-4,6-7,9-10,12-13,20-21H,5,8,11,14H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 248.8°C |
Boiling Point: | 487.9°C at 760 mmHg |
Density: | 1.173g/cm3 |
Refractive index: | 1.644 |
Specification: |
5-Benzyloxy-3-(1-methyl-2-pyrrolidinyl)indole (CAS NO.14226-68-7) is also named as 5-23-12-00064 (Beilstein Handbook Reference) ; BRN 0758312 ; Indole, 5-benzyloxy-3-(1-methyl-2-pyrrolidinyl)- . 5-Benzyloxy-3-(1-methyl-2-pyrrolidinyl)indole (CAS NO.14226-68-7) is highly toxic. It is flammable by fire, heat and oxidants. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep 5-Benzyloxy-3-(1-methyl-2-pyrrolidinyl)indole (CAS NO.14226-68-7) separate from raw materials of food.
|
Flash Point: | 248.8°C |
Safety Data |
|
 |