| Identification |
| Name: | Carbamic acid,N-(6-butyl-1H-benzimidazol-2-yl)-, methyl ester |
| Synonyms: | 2-Benzimidazolecarbamicacid, 5-butyl-, methyl ester (8CI);Carbamic acid, (5-butyl-1H-benzimidazol-2-yl)-,methyl ester (9CI);5-Butyl-2-(carbomethoxyamino)benzimidazole;Helatac;Helmatac;Methyl (5-butyl-1H-benzimidazol-2-yl)carbamate;Methyl5(6)-butyl-2-benzimidazolecarbamate;Methyl 5-butylbenzimidazole-2-carbamate;PBZ (fungicide);Parbendazole;SKF 29044; |
| CAS: | 14255-87-9 |
| EINECS: | 238-133-3 |
| Molecular Formula: | C13H17N3O2 |
| Molecular Weight: | 247.3 |
| InChI: | InChI=1/C13H17N3O2/c1-3-4-5-9-6-7-10-11(8-9)15-12(14-10)16-13(17)18-2/h6-8H,3-5H2,1-2H3,(H2,14,15,16,17) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.234g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.631 |
| Solubility: | <0.1 g/100 mL at 18 ºC |
| Appearance: | solid |
| Flash Point: | °C |
| Storage Temperature: | Keep in a cool, dry, dark location in a tightly sealed container or cylinder. Keep away from incompatible materials, ignition sources and untrained individuals. Secure and label area. Protect containers/cylinders from physical damage. |
| Usage: | Fungicide. |
| Safety Data |
| |
 |
