| Identification | |
| Name: | Fast Blue B |
| Synonyms: | 3,3'-Dimethoxybiphenyl-4,4'-di(diazonium) zinc chloride |
| CAS: | 14263-94-6 |
| EINECS: | 238-153-2 |
| Molecular Formula: | C14H12N4O2.ZnCl4 |
| Molecular Weight: | 475.49 |
| InChI: | InChI=1/C14H12N4O2.4ClH.Zn/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2;;;;;/h3-8H,1-2H3;4*1H;/q+2;;;;;+2/p-4 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | >300 °C(lit.) |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents, alkaline hydroxides. May discolour on exposure to light. |
| Solubility: |
|
| Appearance: | green to brown powder |
| Specification: |
Fast Blue B , its cas register number is 14263-94-6. It also can be called 3,3'-Dimethoxybiphenyl-4,4'-di(diazonium) zinc chloride ; (1,1'-Biphenyl)-4,4'-bis(diazonium), 3,3'-dimethoxy-, (T-4)-tetrachlorozincate(2-) (1:1) ; 3,3'-Dimethoxybiphenyl-4,4'-di(diazonium) zinc chloride .It is a green to brown powder. |
| Flash Point: | °C |
| Storage Temperature: | 2-8°C |
| Safety Data | |
 |
|
