| Identification | |
| Name: | Carbamic acid,N-(6-aminohexyl)- |
| Synonyms: | Carbamicacid, (6-aminohexyl)- (6CI,7CI,8CI,9CI);Diak 1;Diak NBR 1;Hexamethylenediamine carbamate;Keminox AC 6;Keminox AC 6-66;Rhenogran HMDC 70;Rhenogran HMDC 70/AEMD;15487-89-5; |
| CAS: | 143-06-6 |
| EINECS: | 205-581-6 |
| Molecular Formula: | C7H16N2O2 |
| Molecular Weight: | 160.21 |
| InChI: | InChI=1/C7H16N2O2/c8-5-3-1-2-4-6-9-7(10)11/h9H,1-6,8H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 154-158 ºC |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.059g/cm3 |
| Refractive index: | 1.482 |
| Solubility: | Very soluble |
| Appearance: | liquid |
| Specification: |
(6-Aminohexyl)carbamic acid (CAS NO.143-06-6) is also named as Hexamethylenediamine carbamate ; Carbamic acid, (6-aminohexyl)- ; Diak 1 ; HSDB 2585 ; Carbamic acid, N-(6-aminohexyl)- . |
| Flash Point: | °C |
| Usage: | Uses include rubber accelerators used to vulcanize viton fluoroelastomer and polyacrylate elastomers diak, cross-linking agent in rubber processing, latent amine source in polyurethane production. |
| Safety Data | |
 |
|
