| Identification |
| Name: | Benzene,1-bromo-4-chloro-2-methyl- |
| Synonyms: | Toluene,2-bromo-5-chloro- (8CI);1-Bromo-2-methyl-4-chlorobenzene;1-Bromo-4-chloro-2-methylbenzene; |
| CAS: | 14495-51-3 |
| EINECS: | 238-503-4 |
| Molecular Formula: | C7H6BrCl |
| Molecular Weight: | 205.48 |
| InChI: | InChI=1/C7H6BrCl/c1-5-4-6(9)2-3-7(5)8/h2-4H,1H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.543 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.574-1.576 |
| Water Solubility: | INSOLUBLE |
| Solubility: | insoluble in water |
| Appearance: | clear, colorless liquid. |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
