| Identification | |
| Name: | 5-Bromo-2-hydroxyacetophenone |
| Synonyms: | Acetophenone,5'-bromo-2'-hydroxy- (6CI,7CI,8CI);1-(5-Bromo-2-hydroxyphenyl)ethanone;2-Acetyl-4-bromophenol;3-Bromo-6-hydroxyphenyl methyl ketone;5'-Bromo-o-hydroxyacetophenone;NSC 46621; |
| CAS: | 1450-75-5 |
| Molecular Formula: | C8H7BrO2 |
| Molecular Weight: | 215.05 |
| InChI: | InChI=1/C8H7BrO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.586 g/cm3 |
| Refractive index: | 1.591 |
| Appearance: | white crystalline solid |
| Specification: |
5-Bromo-2-hydroxyacetophenone , with CAS number of 1450-75-5, can be called 5'-Bromo-o-hydroxyacetophenone ; Acetophenone,5'-bromo-2'-hydroxy- (6CI,7CI,8CI) ; 1-(5-Bromo-2-hydroxyphenyl)ethanone ; 2-Acetyl-4-bromophenol ; 2'-Hydroxy-5'-bromoacetophenone . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
