| Identification |
| Name: | Benzeneethanamine, a-methyl-, hydrochloride (1:1), (aS)- |
| Synonyms: | Benzeneethanamine,a-methyl-, hydrochloride, (S)-;Benzeneethanamine, a-methyl-, hydrochloride, (aS)- (9CI); Phenethylamine, a-methyl-, hydrochloride, (+)- (8CI); (+)-Amphetamine hydrochloride;(+)-Phenylisopropylamine hydrochloride; (S)-a-Benzylethylamine hydrochloride; Dexamphetaminehydrochloride; Dextroamphetamine hydrochloride; d-Amphetamine hydrochloride |
| CAS: | 1462-73-3 |
| Molecular Formula: | C9H13 N . Cl H |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C9H13N.ClH/c1-8(10)7-9-5-3-2-4-6-9;/h2-6,8H,7,10H2,1H3;1H/t8-;/m0./s1 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 87.4°C |
| Boiling Point: | 201.5°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 87.4°C |
| Usage: | CNS stimulant; anorexic. More active isomer of Amphetamine. Induces release of catecholamines and serotonin by displacing the monoamines from their vesicular storage sites; blocks catecholamine reuptake.
Controlled substance (stimulant). |
| Safety Data |
| |
 |
