| Identification | |
| Name: | Selenomethionine |
| CAS: | 1464-42-2 |
| EINECS: | 215-977-0 |
| Molecular Formula: | C5H11NO2Se |
| Molecular Weight: | 196.11 |
| InChI: | InChI=1/C5H11NO2Se/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3283 |
| Flash Point: | 147.8°C |
| Boiling Point: | 320.8°Cat760mmHg |
| Density: | g/cm3 |
| Water Solubility: | soluble |
| Solubility: | soluble |
| Appearance: | white crystalline solid |
| Specification: |
Selenomethionine is an amino acid containing selenium. The L-isomer of selenomethionine, known as Se-met and Sem, is a common natural food source of selenium.The incorporation of selenomethionine into tissue proteins and keratin in horses causes alkali disease. Alkali disease is characterized by emaciation, loss of hair, deformation and shedding of hooves, loss of vitality and erosion of the joints of long bones. |
| Report: |
Selenium and its compounds are on the Community Right-To-Know List. |
| Flash Point: | 147.8°C |
| Storage Temperature: | −20°C |
| Color: | Transparent, hexagonal sheets or plates; metallic luster of cryst |
| Safety Data | |
| Hazard Symbols |
T:Toxic
N:Dangerousfortheenvironment
|
 |
|
