| Identification | |
| Name: | Cytarabine |
| Synonyms: | 2(1H)-Pyrimidinone,4-amino-1-a-Darabinofuranosyl-;U-19,920;Cytosine Arabinoside;cytarbine;Depocyt (liposomal);Arafcyt;Cytosine, 1-beta-D-arabinofuranosyl-;Cytosine-1-beta-arabinofuranoside;Depocyt (TN);Cytosine beta-D-arabinofuranoside;Erpalfa;Arabitin;Tarabine PFS;ara-Cytosine;Cytarabin;1.beta.-D-Arabinofuranosylcytosine;Udicil;NCI-C04728;.beta.-Cytosine arabinoside;Cytosar U;Aracytin;1-(beta,D-Arabinofuranosyl)cytosine;Cyclocide;2(1H)-Pyrimidinone, 4-amino-1.beta.-D-arabinofuranosyl-;1beta-D-Arabinosylcytosine;Arabinofuranosylcytosine; |
| CAS: | 147-94-4 |
| EINECS: | 205-705-9 |
| Molecular Formula: | C9H13N3O5 |
| Molecular Weight: | 243.21662 |
| InChI: | InChI=1S/C9H13N3O5/c10-5-1-2-12(9(16)11-5)8-7(15)6(14)4(3-13)17-8/h1-2,4,6-8,13-15H,3H2,(H2,10,11,16)/t4-,6-,7+,8-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 212 - 213 C |
| Flash Point: | 283.8°C |
| Boiling Point: | 545.7°C at 760 mmHg |
| Density: | 1.89 g/cm3 |
| Stability: | Stable. |
| Refractive index: | 1.756 |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | fine off-white crystalline powder |
| Flash Point: | 283.8°C |
| Color: | Prisms from 50% ethanol WHITE TO OFF-WHITE CRYSTALLINE POWDER |
| Usage: | Used as an antineoplastic and antiviral. A selective inhibitro of DNA synthesis. Does not inhibit RNA synthesis |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
