| Identification |
| Name: | 3H-Imidazo[4,5-h]quinolin-2-amine,3-methyl- |
| Synonyms: | 3H-Imidazo[4,5-h]quinolin-2-amine,3-methyl-(9CI) |
| CAS: | 147293-13-8 |
| Molecular Formula: | C11H10 N4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C11H10N4/c1-15-8-5-4-7-3-2-6-13-9(7)10(8)14-11(15)12/h2-6H,1H3,(H2,12,14) |
| Molecular Structure: |
![(C11H10N4) 3H-Imidazo[4,5-h]quinolin-2-amine,3-methyl-(9CI)](https://img1.guidechem.com/chem/e/dict/60/147293-13-8.jpg) |
| Properties |
| Flash Point: | 231.2°C |
| Boiling Point: | 458.7°Cat760mmHg |
| Density: | 1.41g/cm3 |
| Refractive index: | 1.754 |
| Flash Point: | 231.2°C |
| Usage: | A closely related isomer to the heterocyclic food mutagen IQ. Useful for biological and structure-activity studies of IQ |
| Safety Data |
| |
 |
