| Identification | |
| Name: | Cyclohexanone,2-(1-methylpropyl)- |
| Synonyms: | Cyclohexanone,2-sec-butyl- (7CI,8CI); 2-(1-Methylpropyl)cyclohexanone;2-sec-Butylcyclohexanone; Freskomenthe; NSC 21146 |
| CAS: | 14765-30-1 |
| EINECS: | 238-830-2 |
| Molecular Formula: | C10H18 O |
| Molecular Weight: | 154.25 |
| InChI: | InChI=1/C10H18O/c1-3-8(2)9-6-4-5-7-10(9)11/h8-9H,3-7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 181 °F |
| Boiling Point: | 76-78 °C8 mm Hg(lit.) |
| Density: | 0.915 |
| Refractive index: | n20/D 1.458(lit.) |
| Specification: |
2-(1-METHYLPROPYL)CYCLOHEXANONE , its cas register number is 14765-30-1. It also can be called 2-(1-methylpropyl)-cyclohexanon ; 2-sec-butyl-cyclohexanon ; FRESKOMENTHE ; FEMA 3261 ; 2-SEC-BUTYLCYCLOHEXANONE . It is hazardous. Moderately toxic by ingestion. Low toxicity by skin contact. When heated to decomposition it emits acrid smoke and irritating vapors. So put 2-(1-METHYLPROPYL)CYCLOHEXANONE (CAS NO.14765-30-1) out of the touch of children and keep it in cool place.
|
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 181 °F |
| Safety Data | |
 |
|
