| Identification | |
| Name: | Benzoic acid,4-(dimethylamino)-, pentyl ester |
| Synonyms: | Benzoicacid, p-(dimethylamino)-, pentyl ester (8CI); Amyl 4-(dimethylamino)benzoate;Amyl N,N-dimethyl-4-aminobenzoate; Amyl N,N-dimethyl-p-aminobenzoate; Amyldimethyl-PABA; Amyl p-(dimethylamino)benzoate; Padimate; Pentylp-dimethylaminobenzoate; n-Pentyl p-dimethylaminobenzoate;p-Dimethylaminobenzoic acid amyl ester |
| CAS: | 14779-78-3 |
| EINECS: | 238-849-6 |
| Molecular Formula: | C14H21 N O2 |
| Molecular Weight: | 235.36 |
| InChI: | InChI=1S/C14H21NO2/c1-4-5-6-11-17-14(16)12-7-9-13(10-8-12)15(2)3/h7-10H,4-6,11H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 120.7°C |
| Boiling Point: | 343.4°Cat760mmHg |
| Density: | 1.017g/cm3 |
| Refractive index: | 1.524 |
| Specification: |
Amyl-p-dimethylaminobenzoate ,its CAS number is 14779-78-3,it can be called 4-(Dimethylamino)benzoic Acid Pentyl Ester ; benzoic acid, 4-(dimethylamino)-, pentyl ester ; p-Dimethylaminobenzoic Acid Pentyl Ester ; Amyl 4-(Dimethylamino)benzoate and so on. It is a toxic substance,with flammability, burning will produce toxic fumes of nitrogen oxides,so it should be stored in cool and dry environment,dry powder,foam,sand, carbon dioxide,water mist can be used if something urgent happened. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 120.7°C |
| Safety Data | |
 |
|
