| Identification |
| Name: | Butanoic acid, 4-chloro-4-oxo-, ethyl ester |
| Synonyms: | Propionicacid, 3-(chloroformyl)-, ethyl ester (6CI,7CI,8CI);3-(Ethoxycarbonyl)propanoylchloride;3-Chlorocarbonylpropionic acid ethyl ester;4-Ethoxy-4-oxobutanoic acid chloride;Ethyl 3-chlorocarbonylpropionate;Ethyl 4-chloro-4-oxobutyrate;b-Ethoxycarbonylpropionyl chloride; |
| CAS: | 14794-31-1 |
| EINECS: | 238-855-9 |
| Molecular Formula: | C6H9ClO3 |
| Molecular Weight: | 164.59 |
| InChI: | InChI=1/C6H9ClO3/c1-2-10-6(9)4-3-5(7)8/h2-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 3265 |
| Density: | 1.155 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.435-1.439 |
| Solubility: | Slightly soluble |
| Appearance: | clear colourless to yellow liquid |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. Store protected from moisture. Do not store in steel container. |
| Sensitive: | Moisture Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
