Identification |
Name: | 1-Butanone,1-(4-fluorophenyl)-4-[4-(2-methoxyphenyl)-1-piperazinyl]- |
Synonyms: | Butyrophenone,4'-fluoro-4-[4-(o-methoxyphenyl)-1-piperazinyl]- (6CI,7CI,8CI); 2028 MD;4-[4-(o-Methoxyphenyl)-1-piperazinyl]-p-fluorobutyrophenone;4'-Fluoro-4-[4-(o-methoxyphenyl)-1-piperazinyl]butyrophenone; Anti-Pica;Fluanison; Fluanisone; Haloanison; Haloanisone; MD 2028; NSC 170977; R 2028; R2167; Sedalande; p-Fluoro-g-[4-(o-methoxyphenyl)-1-piperazinyl]butyrophenone; g-(4-o-Methoxyphenylpiperazino)-4-fluorobutyrophenone |
CAS: | 1480-19-9 |
EINECS: | 216-038-8 |
Molecular Formula: | C21H25 F N2 O2 |
Molecular Weight: | 356.48 |
InChI: | InChI=1/C21H25FN2O2/c1-26-21-7-3-2-5-19(21)24-15-13-23(14-16-24)12-4-6-20(25)17-8-10-18(22)11-9-17/h2-3,5,7-11H,4,6,12-16H2,1H3 |
Molecular Structure: |
|
Properties |
Flash Point: | 263.3°C |
Boiling Point: | 511.8°Cat760mmHg |
Density: | 1.146g/cm3 |
Refractive index: | 1.557 |
Specification: |
It is a typical antipsychotic and sedative of the butyrophenone chemical class.
|
Flash Point: | 263.3°C |
Safety Data |
|
|