| Identification |
| Name: | L-Alanine,3-[(aminocarbonyl)amino]- |
| Synonyms: | Albizziine(6CI);Albizzine (7CI);Propionic acid, 2-amino-3-ureido- (8CI);Albizziin;Albizzin;L-2-Amino-3-ureidopropionic acid;L-Albizziin;L-Albizziine;L-b-Ureidoalanine;NSC 132089; |
| CAS: | 1483-07-4 |
| EINECS: | 216-046-1 |
| Molecular Formula: | C4H9N3O3 |
| Molecular Weight: | 147.13 |
| InChI: | InChI=1/C4H9N3O3/c5-2(3(8)9)1-7-4(6)10/h2H,1,5H2,(H,8,9)(H3,6,7,10)/t2-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 220-223 ºC (dec.) |
| Density: | 1.43 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.55 |
| Alpha: | -23.4 º (C=1, 1M HCL) |
| Solubility: | Very soluble |
| Appearance: | White powder |
| Storage Temperature: | 2-8°C |
| Usage: | Albizziin is a glutamase inhibitor, a glutaminyl-tRNA synthetase inhibitor as well as an intermediate in the synthesis of heterocycles. It is also a potential effector group in affinity chromatography |
| Safety Data |
| Hazard Symbols |
Xi: Irritant
|
| |
 |
