| Identification | |
| Name: | 9H-Carbazole, 9-methyl- |
| Synonyms: | Carbazole,9-methyl- (6CI,7CI,8CI); 9-Methyl-9H-carbazole; 9-Methylcarbazole;N-Methylcarbazole; NSC 121195 |
| CAS: | 1484-12-4 |
| EINECS: | 216-054-5 |
| Molecular Formula: | C13H11 N |
| Molecular Weight: | 181.25 |
| InChI: | InChI=1/C13H11N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2-9H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 90 - 92 C |
| Flash Point: | 158.1°C |
| Boiling Point: | 337.8°Cat760mmHg |
| Density: | 1.09g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.622 |
| Appearance: | white crystalline powder |
| Specification: |
9-Methylcarbazole (CAS NO.1484-12-4) also can be called N-Methylcarbazole ; 9H-Carbazole, 9-methyl- (9CI) ; and Carbazole, 9-methyl- . |
| Flash Point: | 158.1°C |
| Safety Data | |
 |
|
