| Identification |
| Name: | 9H-Carbazole,9-ethenyl- |
| Synonyms: | Carbazole,9-vinyl- (6CI,8CI); 9-Ethenyl-9H-Carbazole; 9-Vinyl-9H-carbazole;9-Vinylcarbazole; N-Ethenylcarbazole; N-Vinylcarbazole; NSC 406868 |
| CAS: | 1484-13-5 |
| EINECS: | 216-055-0 |
| Molecular Formula: | C14H11 N |
| Molecular Weight: | 193.24384 |
| InChI: | InChI=1S/C14H11N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h2-10H,1H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2811 |
| Melting Point: | 60-65 ºC |
| Boiling Point: | 154-155 ºC (3 mmHg) |
| Density: | 1.05 g/cm3 |
| Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
| Refractive index: | 1.77 |
| Water Solubility: | Stability Stable. Incompatible with strong acids, strong oxidizing agents. Toxicology Harmful if swallowed or absorbed through the skin. Toxicity data (The mean |
| Solubility: | |
| Appearance: | slightly brown crystalline solid |
| Packinggroup: | II |
| Storage Temperature: | 2-8°C |
| Safety Data |
| |
 |
