Identification |
Name: | 9H-Carbazole,9-ethenyl- |
Synonyms: | Carbazole,9-vinyl- (6CI,8CI); 9-Ethenyl-9H-Carbazole; 9-Vinyl-9H-carbazole;9-Vinylcarbazole; N-Ethenylcarbazole; N-Vinylcarbazole; NSC 406868 |
CAS: | 1484-13-5 |
EINECS: | 216-055-0 |
Molecular Formula: | C14H11 N |
Molecular Weight: | 193.24384 |
InChI: | InChI=1S/C14H11N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h2-10H,1H2 |
Molecular Structure: |
 |
Properties |
Transport: | UN 2811 |
Melting Point: | 60-65 ºC |
Boiling Point: | 154-155 ºC (3 mmHg) |
Density: | 1.05 g/cm3 |
Stability: | Stable. Incompatible with strong acids, strong oxidizing agents. |
Refractive index: | 1.77 |
Water Solubility: | Stability Stable. Incompatible with strong acids, strong oxidizing agents. Toxicology Harmful if swallowed or absorbed through the skin. Toxicity data (The mean |
Solubility: | |
Appearance: | slightly brown crystalline solid |
Packinggroup: | II |
Storage Temperature: | 2-8°C |
Safety Data |
|
 |