| Identification | |
| Name: | Pregabalin |
| Synonyms: | Hexanoic acid, 3-(aminomethyl)-5-methyl-, (S)-;3-isobutyl GABA;(R-)-3-isobutyl GABA;CI 1008;PD 144723;CI-1008;Hexanoic acid, 3-(aminomethyl)-5-methyl-, (3S)-;Lyrica;Pregablin;(3S)-3-(aminomethyl)-5-methylhexanoic acid;(S)-(+)-3-Aminomethyl-5-methylhexanoic acid; |
| CAS: | 148553-50-8 |
| Molecular Formula: | C8H17NO2 |
| Molecular Weight: | 159.23 |
| InChI: | InChI=1/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.997 g/cm3 |
| Refractive index: | 1.464 |
| Solubility: | Freely soluble in water and both basic and acidic solutions In water, 1.2X10+4 mg/L at 25 deg C (est) |
| Appearance: | White or almost white crystalline powder |
| Color: | White to off-white crystalline solid |
| Usage: | S-Enantiomer of Pregabalin. A GABA analogue used as an anticonvulsant |
| Safety Data | |
 |
|
