| Identification | |
| Name: | Erythritol |
| Synonyms: | 1,2,3,4-Butanetetrol, (R*,S*)-;Erythritol, meso-;Butanetetrol;1,2,3,4-Tetrahydroxybutane;Phycite;Phycitol;(2S,3S)-butane-1,2,3,4-tetrol;Erythrite;(2R,3S)-butane-1,2,3,4-tetrol;butane-1,2,3,4-tetrol; |
| CAS: | 149-32-6 |
| EINECS: | 205-737-3 |
| Molecular Formula: | C4H10O4 |
| Molecular Weight: | 122.12 |
| InChI: | InChI=1/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.45 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.536 |
| Water Solubility: | soluble |
| Solubility: | H2O: 0.1 g/mL, clear to almost clear, colorless |
| Appearance: | white crystals or powder |
| Specification: |
?Erythritol , its CAS NO. is 149-32-6, the synonyms are meso-Erythritol ; 1,2,3,4-Butanetetrol ; meso-1,2,3,4-Tetrahydroxybutane . |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
