| Identification | |
| Name: | D-Tryptophan methyl ester hydrochloride |
| CAS: | 14907-27-8 |
| EINECS: | 231-385-5 |
| Molecular Formula: | C12H14N2O2.HCl |
| Molecular Weight: | 254.71 |
| InChI: | InChI=1/C12H14N2O2.ClH/c1-16-12(15)10(13)6-8-7-14-11-5-3-2-4-9(8)11;/h2-5,7,10,14H,6,13H2,1H3;1H/t10-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | OTH |
| Density: | g/cm3 |
| Solubility: | Appearance:White to off-white crystalline powder Transport Information: OTH Hazard Symbols:Not regulated UN NO. particular:particular |
| Appearance: | White to off-white crystalline powder |
| Safety Data | |
| Hazard Symbols | |
 |
|
