| Identification | |
| Name: | Benzo[f][1]benzothieno[3,2-b]quinoline(7CI,8CI,9CI) |
| Synonyms: | Benzo[f][1]benzothieno[3,2-b]quinoline |
| CAS: | 1491-10-7 |
| Molecular Formula: | C19H11 N S |
| Molecular Weight: | 285.37 |
| InChI: | InChI=1/C19H11NS/c1-2-6-13-12(5-1)9-10-16-15(13)11-18-19(20-16)14-7-3-4-8-17(14)21-18/h1-11H |
| Molecular Structure: | ![(C19H11NS) Benzo[f][1]benzothieno[3,2-b]quinoline](https://img1.guidechem.com/chem/e/dict/40/1491-10-7.jpg) |
| Properties | |
| Flash Point: | 266.6°C |
| Boiling Point: | 533.2°Cat760mmHg |
| Density: | 1.367g/cm3 |
| Refractive index: | 1.861 |
| Specification: |
Benzo(f)(1)benzothieno(3,2-b)quinoline , its CAS number is 1491-10-7, it can be called Benzo(11,12)chryseno(5,6-b)oxirene, 1a,13c-dihydro- . Benzo(f)(1)benzothieno(3,2-b)quinoline (CAS NO. 1491-10-7) is a toxic substance, with flammability, burning will produce toxic fumes of nitrogen oxides and hydrogen chloride, so it should be stored in cool and dry environment, dry powder, foam,sand, carbon dioxide, water mist can be used if something urgent happened. |
| Flash Point: | 266.6°C |
| Safety Data | |
 |
|
