| Identification |
| Name: | 4-Pentylphenol |
| Synonyms: | P-N-PENTYLPHENOL; P-N-AMYL PHENOL; P-PENTYLPHENOL; 4-N-PENTYLPHENOL; 4-N-AMYLPHENOL; 4-AMYLPHENOL; 4-pentyl-pheno; Amyl p-hydroxybenzene |
| CAS: | 14938-35-3 |
| EINECS: | 239-015-4 |
| Molecular Formula: | C11H16O |
| Molecular Weight: | 164.24 |
| InChI: | InChI=1/C11H16O/c1-2-3-4-5-10-6-8-11(12)9-7-10/h6-9,12H,2-5H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2430 |
| Density: | 0.96 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.512-1.514 |
| Solubility: | Insoluble |
| Appearance: | Colorless liquid with a phenol-like odor. |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Intermediates of Liquid Crystals |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
