| Identification | |
| Name: | 7-Dodecen-1-ol,acetate, (7Z)- |
| Synonyms: | 7-Dodecen-1-ol,acetate, (Z)- (8CI); (Z)-1-Acetoxy-7-dodecene; (Z)-7-Dodecen-1-ol acetate;(Z)-7-Dodecen-1-yl acetate; (Z)-7-Dodecenyl acetate; Looplure; MK 26;cis-1-Acetoxy-7-dodecene; cis-7-Dodecen-1-ol acetate; cis-7-Dodecen-1-ylacetate; cis-7-Dodecenyl acetate |
| CAS: | 14959-86-5 |
| EINECS: | 239-031-1 |
| Molecular Formula: | C14H26 O2 |
| Molecular Weight: | 226.40 |
| InChI: | InChI=1S/C14H26O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h6-7H,3-5,8-13H2,1-2H3/b7-6- |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 96.5°C |
| Boiling Point: | 300.1°Cat760mmHg |
| Density: | 0.881g/cm3 |
| Refractive index: | 1.448 |
| Specification: |
7-Dodecen-1-yl acetate , its cas register number is 14959-86-5. It also can be called (Z)-7-Dodecen-1-ol acetate ; (Z)-7-Dodecen-1-olacetate ; (Z)-7-Dodecenyl acetate ; Cabblemone ; Looplure ; and Pherocon CL . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 96.5°C |
| Safety Data | |
 |
|
