| Identification | |
| Name: | L-Lysine,N6-(1-iminoethyl)-, hydrochloride (1:1) |
| Synonyms: | L-Lysine,N6-(1-iminoethyl)-, monohydrochloride (9CI) |
| CAS: | 150403-89-7 |
| Molecular Formula: | C8H17 N3 O2 . Cl H |
| Molecular Weight: | 188.24742 |
| InChI: | InChI=1S/C8H17N3O2/c1-6(9)11-5-3-2-4-7(10)8(12)13/h7H,2-5,10H2,1H3,(H2,9,11)(H,12,13)/p+1/t7-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | white to off-white solid |
| Specification: |
L-N6-(1-iminoethyl)lysine dihydrochloride ,its CAS NO. is 150403-89-7,the synonyms is L-N6-(1-iminoethyl)-lysine (acetate salt) ; L-N6-(1-iminoethyl)lysine, dihcl ; L-N6-(1-iminoethyl)lysine dihydrochloride ; L-N6-(1-iminoethyl) lysine, hydrochloride ; L-N6-(1-iminoethyl)-lysine 2hcl ; L-Nil ; L-Nil dihydrochloride ; L-Nil hcl . |
| Biological Activity: | A selective inhibitor of inducible nitric oxide synthase (IC 50 = 3.3 μ M). |
| Storage Temperature: | −20°C |
| Usage: |
L-N6-(1-iminoethyl)lysine is an irreversible inhibitor of mammalian nitric oxide synthase. |
| Safety Data | |
| Hazard Symbols | |
 |
|
