| Identification | |
| Name: | Retigabine |
| Synonyms: | Carbamicacid, [2-amino-4-[[(4-fluorophenyl)methyl]amino]phenyl]-, ethyl ester (9CI);Ethyl [2-amino-4-[[(4-fluorophenyl)methyl]amino]phenyl]carbamate; |
| CAS: | 150812-12-7 |
| Molecular Formula: | C16H18FN3O2 |
| Molecular Weight: | 303.33 |
| InChI: | InChI=1/C16H18FN3O2/c1-2-22-16(21)20-15-8-7-13(9-14(15)18)19-10-11-3-5-12(17)6-4-11/h3-9,19H,2,10,18H2,1H3,(H,20,21) |
| Molecular Structure: | ![(C16H18FN3O2) Carbamicacid, [2-amino-4-[[(4-fluorophenyl)methyl]amino]phenyl]-, ethyl ester (9CI);Ethyl [2-amino-4...](https://img.guidechem.com/casimg/150812-12-7.gif) |
| Properties | |
| Flash Point: | 213.9 ºC |
| Boiling Point: | 430 ºC at 760 mmHg |
| Density: | 1.307 g/cm3 |
| Refractive index: | 1.655 |
| Specification: |
Retigabine (CAS NO.150812-12-7), its Synonyms are Carbamic acid, (2-amino-4-(((4-fluorophenyl)methyl)amino)phenyl)-, ethyl ester ; Ethyl (2-amino-4-(((4-fluorophenyl)methyl)amino)phenyl)carbamate ; Ethyl 2-amino-4-((p-fluorobenzyl)amino)carbanilate ; N-(2-Amino-4-(4-fluorobenzylamino)phenyl)carbamic acid ethyl ester . |
| Flash Point: | 213.9 ºC |
| Usage: |
Retigabine (CAS NO.150812-12-7) is an anticonvulsant currently pending approval as an adjunctive treatment for partial-onset seizures in adults with refractory epilepsy in the United States. |
| Safety Data | |
 |
|
