| Identification | |
| Name: | 2,4,6(1H,3H,5H)-Pyrimidinetrione,1-methyl-5-(1-methyl-2-pentyn-1-yl)-5-(2-propen-1-yl)- |
| Synonyms: | Methohexital;Methohexitone;2,4,6(1H,3H,5H)-Pyrimidinetrione,1-methyl-5-(1-methyl-2-pentynyl)-5-(2-propenyl)- (9CI);Barbituric acid,5-allyl-1-methyl-5-(1-methyl-2-pentynyl)- (6CI,7CI,8CI);5-Allyl-5-(3-hexyn-2-yl)-1-methylbarbituric acid;Brevital;Brietal;Compound22451;Compound 25398;Enallynymall;Methodrexitone;Methohexital; |
| CAS: | 151-83-7 |
| EINECS: | 205-798-6 |
| Molecular Formula: | C14H18 N2 O3 |
| Molecular Weight: | 262.31 |
| InChI: | InChI=1/C14H18N2O3/c1-5-7-8-10(3)14(9-6-2)11(17)15-13(19)16(4)12(14)18/h6,10H,2,5,9H2,1,3-4H3,(H,15,17,19) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.113 |
| Refractive index: | 1.504 |
| Specification: |
Preparations of Methohexitone (CAS NO.151-83-7) is used for injections.and can be addictive. |
| Packinggroup: | III |
| Flash Point: | °C |
| Safety Data | |
 |
|
