| Identification | |
| Name: | Benzoyl chloride,4-bromo-2-fluoro- |
| Synonyms: | 2-Fluoro-4-bromobenzoylchloride; 4-Bromo-2-fluorobenzoyl chloride |
| CAS: | 151982-51-3 |
| Molecular Formula: | C7H3 Br Cl F O |
| Molecular Weight: | 237.45 |
| InChI: | InChI=1/C7H3BrClFO/c8-4-1-2-5(7(9)11)6(10)3-4/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3265 |
| Density: | 1.742 g/cm3 |
| Refractive index: | 1.5877 |
| Appearance: | white to light yellow liquid or crystalline mass |
| Specification: |
2-Fluoro-4-bromobenzoyl chloride , its cas register number is 151982-51-3. It also can be called Benzoyl chloride,4-bromo-2-fluoro- .It is a white to light yellow liquid or crystalline mass . |
| Packinggroup: | II |
| Sensitive: | Lachrymatory |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
