| Identification | |
| Name: | L-Cysteine,N-acetyl-S-(2-hydroxyphenylethyl)- (9CI) |
| Synonyms: | (2R)-2-acetamido-3-[2-(2-hydroxyphenyl)ethylsulfanyl]propanoic acid |
| CAS: | 152155-79-8 |
| Molecular Formula: | C13H17 N O4 S |
| Molecular Weight: | 283.37 |
| InChI: | InChI=1/C13H17NO4S/c1-9(15)14-11(13(17)18)8-19-7-6-10-4-2-3-5-12(10)16/h2-5,11,16H,6-8H2,1H3,(H,14,15)(H,17,18)/t11-/m0/s1 |
| Molecular Structure: | ![(C13H17NO4S) (2R)-2-acetamido-3-[2-(2-hydroxyphenyl)ethylsulfanyl]propanoic acid](https://img1.guidechem.com/chem/e/dict/148/152155-79-8.jpg) |
| Properties | |
| Flash Point: | 306.3°C |
| Boiling Point: | 582.9°Cat760mmHg |
| Density: | 1.299g/cm3 |
| Refractive index: | 1.593 |
| Specification: |
N-Acetyl-S-(2-hydroxyphenylethyl)-L-cysteine (CAS NO.152155-79-8) is also named as L-Cysteine, N-acetyl-S-(2-hydroxyphenylethyl)- . N-Acetyl-S-(2-hydroxyphenylethyl)-L-cysteine (CAS NO.152155-79-8) is highly toxic. It is flammable. It will produce toxic nitrogen oxide and sulfur oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 306.3°C |
| Safety Data | |
 |
|
