| Identification | |
| Name: | Isoquinoline,6,7-dimethoxy- |
| Synonyms: | 6,7-Dimethoxyisoquinoline;Backebergine; |
| CAS: | 15248-39-2 |
| Molecular Formula: | C11H11NO2 |
| Molecular Weight: | 189.21 |
| InChI: | InChI=1/C11H11NO2/c1-13-10-5-8-3-4-12-7-9(8)6-11(10)14-2/h3-7H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 117.2°C |
| Boiling Point: | 319.9°Cat760mmHg |
| Density: | 1.148g/cm3 |
| Refractive index: | 1.589 |
| Appearance: | Off-white solid |
| Specification: |
6,7-Dimethoxyisoquinoline with cas registry number of 15248-39-2 is also called Backebergine . It belongs to heterocyclic compounds. According to the IUPAC method, 6,7-Dimethoxyisoquinoline is also the IUPAC name for this compound. Based on its structrue, there are many 6,7-dimethoxyisoquinoline derivatives such as 3-Ethyl-6,7-dimethoxyisoquinoline which have some effect on the function of blood platelets. As a commodity, this compoud can be obtained by custom synthesis. |
| Flash Point: | 117.2°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
