| Identification | |
| Name: | Propanamide,N,N-diethyl-2-(1-naphthalenyloxy)- |
| CAS: | 15299-99-7 |
| EINECS: | 239-333-3 |
| Molecular Formula: | C17H21NO2 |
| Molecular Weight: | 271.36 |
| InChI: | InChI=1/C17H21NO2/c1-4-18(5-2)17(19)13(3)20-16-12-8-10-14-9-6-7-11-15(14)16/h6-13H,4-5H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.079 g/cm3 |
| Refractive index: | 1.568 |
| Water Solubility: | very soluble in acetone, ethanol, xylene, and hexane |
| Solubility: | very soluble in acetone, ethanol, xylene, and hexane |
| Appearance: | White-like crystal |
| Specification: |
Propanamide,N,N-diethyl-2-(1-naphthalenyloxy)- (CAS NO.15299-99-7) is also called 2-(1-Naphthoxy)-N,N-diethylpropionamide ; 2-(alpha-Naphthoxy)-N,N-diaethyl-propionsaeureamid ; 2-(alpha-Naphthoxy)-N,N-diaethyl-propionsaeureamid [German] ; 2-(alpha-Naphthoxy)-N,N-diethylpropionamide ; BRN 2217870 ; Caswell No. 590A ; Devrinol ; EPA Pesticide Chemical Code 103001 ; HSDB 6710 ; N,N-Diethyl-2-(1-naphthalenyloxy)propanamide ; N,N-Diethyl-2-(1-naphthalenyloxy)propionamide ; N,N-Diethyl-2-(1-naphthyloxy)propionamide ; Napropamid ; Napropamide ; Napropamide [ISO:PROP] ; R 7465 ; R-7465 ; R-7475 ; Racemic devrinol ; Waylay . It is lowly toxic. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. Keep Propanamide,N,N-diethyl-2-(1-naphthalenyloxy)- (CAS NO.15299-99-7) separate from raw materials of food. |
| Color: | Colorless crystals; (tech., brown solid) Brown solid Light brown solid from n-pentane. White crystals when pure |
| Safety Data | |
 |
|
