| Identification | |
| Name: | diclofenac sodium |
| Synonyms: | Diclofenac sodium salt; 2-[(2,6-dichlorophenyl)amino]benzeneacetic acid sodium salt; sodium [2-[(2,6-dichlorophenyl)amino]phenyl]acetate; 2[(2,6-dichlorophenyl)amino]-benzeneacetic aci monosodium |
| CAS: | 15307-79-6 |
| EINECS: | 239-346-4 |
| Molecular Formula: | C14H10Cl2NNaO2 |
| Molecular Weight: | 318.13 |
| InChI: | InChI=1/C14H11Cl2NO2.Na/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19;/h1-7,17H,8H2,(H,18,19);/q;+1/p-1 |
| Molecular Structure: | ![(C14H10Cl2NNaO2) Diclofenac sodium salt; 2-[(2,6-dichlorophenyl)amino]benzeneacetic acid sodium salt; sodium [2-[(2,6...](https://img.guidechem.com/casimg/15307-79-6.gif) |
| Properties | |
| Transport: | UN 2811 |
| Stability: | Stable. |
| Water Solubility: | Water solubility: 50 mg/mL |
| Solubility: | Water solubility: 50 mg/mL |
| Appearance: | white or off-white powder |
| Specification: |
?Diclofenac sodium , its cas register number is 15307-79-6. It also can be called 2-[(2,6-Dichlorophenyl)amino]benzeneacetic acid sodium salt ; Voltaren ; and Diclofenac . |
| Packinggroup: | III |
| Storage Temperature: | Keep tightly closed. |
| Usage: | A nonsteroidal anti-inflammatory compound and cyclooxygenase (COX) inhibitor |
| Safety Data | |
| Hazard Symbols |
T:Toxic
|
 |
|
