| Identification |
| Name: | D-Glucitol,1,5-anhydro- |
| Synonyms: | D-Glucose,1-deoxy- (7CI);Glucitol, 1,5-anhydro-, D- (8CI);Polygalitol (6CI);1,5-Anhydroglucitol;1,5-Anhydrosorbitol;1-Deoxy-D-glucopyranose;Aceritol; |
| CAS: | 154-58-5 |
| EINECS: | 205-829-3 |
| Molecular Formula: | C6H12O5 |
| Molecular Weight: | 164.15 |
| InChI: | InChI=1/C6H12O5/c7-1-4-6(10)5(9)3(8)2-11-4/h3-10H,1-2H2/t3?,4?,5-,6-/m1/s1 |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | 142-143ºC |
| Flash Point: | 181.7 ºC |
| Boiling Point: | 376.8 ºC at 760 mmHg |
| Density: | 1.533 g/cm3 |
| Refractive index: | 1.581 |
| Appearance: | White crystals |
| Flash Point: | 181.7 ºC |
| Usage: | This compound has been isolated from several plant and animal sources, discovered in human cerebrospinal fluid and blood plasma and found to be an inhibitor of several enzymes. Anhydroalditols are a class of reduced sugars which are present in many natur |
| Safety Data |
| |
 |
