| Identification | |
| Name: | Melamine pyrophosphate |
| Synonyms: | Diphosphoric acid,compd. with 1,3,5-triazine-2,4,6-triamine;Aeroguard MPP;Melamine, compd. with diphosphoric acid; |
| CAS: | 15541-60-3 |
| EINECS: | 239-590-1 |
| Molecular Formula: | C3H6N6.xH4O7P2 |
| Molecular Weight: | 304.095 |
| InChI: | InChI=1/C3H6N6.H4O7P2/c4-1-7-2(5)9-3(6)8-1;1-8(2,3)7-9(4,5)6/h(H6,4,5,6,7,8,9);(H2,1,2,3)(H2,4,5,6) |
| Molecular Structure: |  |
| Properties | |
| Appearance: | white power |
| Specification: |
Melamine Pyrophosphate , its cas register number 15541-60-3. It also can be called Diphosphoric acid - 1,3,5-triazine-2,4,6-triamine (1:1) ; Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:?) ; and Melamine, compd. with diphosphoric acid . |
| Safety Data | |
 |
|
