| Identification | |
| Name: | b-D-Glucopyranoside,5-bromo-4-chloro-1H-indol-3-yl |
| Synonyms: | Indole,5-bromo-4-chloro-3-(b-D-glucopyranosyloxy)- (7CI,8CI);4-Chloro-5-bromo-3-indolyl-b-D-glucoside;5-Bromo-4-chloro-3-indolyl b-D-glucopyranoside;5-Bromo-4-chloro-3-indolyl b-D-glucoside;X-Glucoside; |
| CAS: | 15548-60-4 |
| EINECS: | 239-603-0 |
| Molecular Formula: | C14H15BrClNO6 |
| Molecular Weight: | 408.629 |
| InChI: | InChI=1S/C14H15BrClNO6/c15-5-1-2-6-9(10(5)16)7(3-17-6)22-14-13(21)12(20)11(19)8(4-18)23-14/h1-3,8,11-14,17-21H,4H2/t8-,11-,12+,13-,14-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 249-251 oC |
| Density: | 1.882 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.731 |
| Alpha: | -81 o (C=1, DMF) |
| Water Solubility: | DMF: 50 mg/mL, clear, colorless to very faintly yellow |
| Solubility: | DMF: 50 mg/mL, clear, colorless to very faintly yellow |
| Appearance: | White microcrystalline powder |
| Specification: |
beta-D-Glucopyranoside,5-bromo-4-chloro-1H-indol-3-yl , its CAS NO. is 15548-60-4, the synonyms are 5-Bromo-4-chloro-3-indoxylglucoside ; 5-Bromo-4-chloroindol-3-yl-beta-D-glucopyranoside . |
| Safety Data | |
 |
|
