Identification |
Name: | Benzene,1-(bromomethyl)-4-isothiocyanato- |
Synonyms: | 1-Bromomethyl-4-(isothiocyanato)benzene;4-(Bromomethyl)phenyl isothiocyanate |
CAS: | 155863-32-4 |
Molecular Formula: | C8H6BrNS |
Molecular Weight: | 228.11 |
InChI: | InChI=1/C8H6BrNS/c9-5-7-1-3-8(4-2-7)10-6-11/h1-4H,5H2 |
Molecular Structure: |
|
Properties |
Transport: | UN 2811 6.1/PG 3 |
Flash Point: | 141.594°C |
Boiling Point: | 310.514°C at 760 mmHg |
Density: | 1.438g/cm3 |
Refractive index: | 1.607 |
Water Solubility: | chloroform: 0.1 g/mL, clear, colorless to light greenish-yellow |
Solubility: | chloroform: 0.1 g/mL, clear, colorless to light greenish-yellow |
Flash Point: | 141.594°C |
Safety Data |
Hazard Symbols |
T: Toxic
|
|
|