| Identification | |
| Name: | Ethanol,2-[(2-ethylhexyl)oxy]- |
| Synonyms: | 2-(2-Ethylhexyloxy)ethanol;EHG; Ethylene glycol mono-2-ethylhexyl ether |
| CAS: | 1559-35-9 |
| EINECS: | 216-323-7 |
| Molecular Formula: | C10H22 O2 |
| Molecular Weight: | 174.32 |
| InChI: | InChI=1/C10H22O2/c1-3-5-6-10(4-2)9-12-8-7-11/h10-11H,3-9H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 8/PG 3 |
| Flash Point: | 64°C |
| Boiling Point: | 224.8°Cat760mmHg |
| Density: | 0.88g/cm3 |
| Refractive index: | n20/D 1.435(lit.) |
| Specification: | Safety Statements:26-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 64°C |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
