| Identification | |
| Name: | 4-Hydroxyphenylacetic acid |
| Synonyms: | p-Hydroxyphenylacetic acid; P-Hydroxyphenyl acetic acid |
| CAS: | 156-38-7 |
| EINECS: | 205-851-3 |
| Molecular Formula: | C8H8O3 |
| Molecular Weight: | 152.15 |
| InChI: | InChI=1/C8H8O3/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.319 g/cm3 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Water Solubility: | 1.73E+04 mg/L in water |
| Solubility: | 1.73E+04 mg/L in water |
| Appearance: | white or light yellow crystalline powder |
| Specification: |
?4-Hydroxyphenylacetic acid (CAS NO.156-38-7) is also named as (4-Hydroxyphenyl)acetic acid ; (p-Hydroxyphenyl)acetic acid ; 4-10-00-00543 (Beilstein Handbook Reference) ; 4-Carboxymethylphenol ; 4-Hydroxybenzeneacetic acid ; 4-Hydroxyphenylacetate ; AI3-17755 ; BRN 1448766 ;?NSC 25066 ; Parahydroxy phenylacetic acid .?4-Hydroxyphenylacetic acid (CAS NO.156-38-7) is white or light yellow crystalline powder.?It is?soluble in ether, ethanol and ethyl acetate. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29182990 |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
