| Identification | |
| Name: | 4-Chloro-2,6-diaminopyrimidine |
| Synonyms: | 2,4-Diamino-6-chloropyrimidine; 2,4-Diamino-6-Chloro Pyridine; 4-Chloro-2,6-pyrimidinediamine; 2,6-Diamino-4-chloropyrimidine; 6-Chloropyrimidine-2,4-diamine; 2,4-Diamino-6-Chloro Pyrimidine |
| CAS: | 156-83-2 |
| EINECS: | 205-863-9 |
| Molecular Formula: | C4H5ClN4 |
| Molecular Weight: | 144.56 |
| InChI: | InChI=1/C4H5ClN4/c5-2-1-3(6)9-4(7)8-2/h1H,(H4,6,7,8,9) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Density: | 1.564 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.702 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly soluble |
| Appearance: | White Cyrstalline Solid |
| Specification: |
??4-Chloro-2,6-diaminopyrimidine ,?its cas register number is 156-83-2. It also can be called?2,4-pyrimidinediamine, 6-chloro- ; 6-chloropyrimidine-2,4-diamine ;?2-amino-4-chloro-6-methyl pyrimidine?.?4-Chloro-2,6-diaminopyrimidine (CAS NO.156-83-2) is a?white cyrstalline solid. |
| HS Code: | 29335995 |
| Storage Temperature: | Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
