Identification |
Name: | 7-Benzofuranol,2,3-dihydro-2-methyl-, 7-(methylcarbamate) |
Synonyms: | 7-Benzofuranol,2,3-dihydro-2-methyl-, methylcarbamate (9CI); Carbamic acid, methyl-,2,3-dihydro-2-methyl-7-benzofuranyl ester (7CI,8CI);2,3-Dihydro-2-methyl-7-benzofuranyl methylcarbamate;2,3-Dihydro-2-methylbenzoylfuranyl-7 N-methylcarbamate;2,3-Dihydro-2-methylfuran-7-yl N-methylcarbamate;2,3-Dihydro-2-methylfuran-7-yl methylcarbamate; BAY 62863; Bayer 62863;Decarbofuran; OMS 1094 |
CAS: | 1563-67-3 |
Molecular Formula: | C11H13 N O3 |
Molecular Weight: | 207.25 |
InChI: | InChI=1/C11H13NO3/c1-7-6-8-4-3-5-9(10(8)14-7)15-11(13)12-2/h3-5,7H,6H2,1-2H3,(H,12,13) |
Molecular Structure: |
 |
Properties |
Flash Point: | 142.6°C |
Boiling Point: | 312.1°C at 760 mmHg |
Density: | 1.177g/cm3 |
Refractive index: | 1.538 |
Specification: | Safety Statements:13-36/37-45 13:Keep away from food, drink and animal feeding stuffs 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical
advice immediately (show label where possible) |
Flash Point: | 142.6°C |
Safety Data |
|
 |