| Identification | |
| Name: | Ibuprofen |
| Synonyms: | alpha-methyl-4-(2-methylpropyl)benzeneacetic acid; 2-(4-isobutylphenyl)-propionic acid; p-isobutylhydratropic acid; RARECHEM AL BO 0989; MOTRIN(TM); (+/-)-2-(4-ISOBUTYLPHENYL)-PROPIONIC ACID; 2-(4-ISOBUTYLPHENYL)PROPIONIC ACID; 4-ISOBUTYL-ALPHA-METHYLPHENYLACETIC ACID; AKOS NCG1-0060; (+/-)-ALPHA-METHYL-4-(2-METHYLPROPYL)-BENZENEACETIC ACID; ALPHA-METHYL-4-[2-METHYLPROPYL]BENZENEACETIC ACID |
| CAS: | 15687-27-1 |
| EINECS: | 239-784-6 |
| Molecular Formula: | C13H18O2 |
| Molecular Weight: | 206.28 |
| InChI: | InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Density: | 1.029g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents. |
| Water Solubility: | insoluble |
| Solubility: | insoluble in water |
| Appearance: | Colourless, Crystalline Solid |
| Specification: |
? Ibuprofen (CAS NO.15687-27-1), its Synonyms are (+-)-2-(p-Isobutylphenyl)propionic acid ; (+-)-Ibuprofen ; (+-)-alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid ; (+-)-p-Isobutylhydratropic acid ; (4-Isobutylphenyl)-alpha-methylacetic acid ; Acide (isobutyl-4-phenyl)-2 propionique ; Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl)- ; p-Isobutyl-2-phenylpropionic acid . |
| Packinggroup: | III |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | Colorless, crystalline stable solid |
| Usage: | A selective cyclooxygenase inhibitor (IC50=14.9uM). Inhibits PGH synthase-1 and PGH synthase-2 with comparable potency |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
