Identification |
Name: | 2-Propanol, 1-ethoxy- |
Synonyms: | Ethyl Proxitol;NSC 2404; |
CAS: | 1569-02-4 |
EINECS: | 216-374-5 |
Molecular Formula: | C5H12O2 |
Molecular Weight: | 104.15 |
InChI: | InChI=1/C5H12O2/c1-3-7-4-5(2)6/h5-6H,3-4H2,1-2H3 |
Molecular Structure: |
|
Properties |
Transport: | 1987 |
Density: | 0.897 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.405-1.409 |
Water Solubility: | soluble |
Solubility: | Soluble |
Appearance: | Clear colorless liquid |
Specification: | Clear colorless liquid Safety Statements:24 24:Avoid contact with skin |
Report: |
Glycol ether compounds are on the Community Right-To-Know List.
|
Packinggroup: | III |
Storage Temperature: | Flammables area |
Safety Data |
|
|