| Identification | |
| Name: | 2-Propanol, 1-ethoxy- |
| Synonyms: | Ethyl Proxitol;NSC 2404; |
| CAS: | 1569-02-4 |
| EINECS: | 216-374-5 |
| Molecular Formula: | C5H12O2 |
| Molecular Weight: | 104.15 |
| InChI: | InChI=1/C5H12O2/c1-3-7-4-5(2)6/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 1987 |
| Density: | 0.897 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.405-1.409 |
| Water Solubility: | soluble |
| Solubility: | Soluble |
| Appearance: | Clear colorless liquid |
| Specification: | Clear colorless liquid Safety Statements:24 24:Avoid contact with skin |
| Report: |
Glycol ether compounds are on the Community Right-To-Know List. |
| Packinggroup: | III |
| Storage Temperature: | Flammables area |
| Safety Data | |
 |
|
