| Identification |
| Name: | Pyrazine, 2,3-diethyl- |
| Synonyms: | 2-Ethyl-3-methyl pyrazine;2-Methyl-3-ethylpyrazine;3-Ethyl-2-methylpyrazine; |
| CAS: | 15707-24-1 |
| EINECS: | 239-800-1 |
| Molecular Formula: | C8H12N2 |
| Molecular Weight: | 136.2 |
| InChI: | InChI=1/C8H12N2/c1-3-7-8(4-2)10-6-5-9-7/h5-6H,3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | HAZARD
|
| Density: | 0.963 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.499-1.501 |
| Water Solubility: | slightly soluble |
| Solubility: | slightly
soluble
|
| Appearance: | clear
to pale yellow liquid |
| Storage Temperature: | Keep away from sources of ignition. Store in a cool, dry place. Store in a tightly closed container. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
