| Identification | |
| Name: | Propanoic acid,2-cyano-, ethyl ester |
| Synonyms: | Propionicacid, 2-cyano-, ethyl ester (6CI,7CI,8CI);2-Cyanopropanoic acid ethyl ester;Ethyl 2-cyanopropanoate;Ethyl 2-cyanopropionate;Ethyl a-cyanopropionate;NSC 68508; |
| CAS: | 1572-99-2 |
| EINECS: | 216-393-9 |
| Molecular Formula: | C6H9NO2 |
| Molecular Weight: | 127.14 |
| InChI: | InChI=1/C6H9NO2/c1-3-9-6(8)5(2)4-7/h5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3276 |
| Density: | 1,01 g/cm3 |
| Refractive index: | 1.418 |
| Specification: | Safety Statements:23-36/37/39 23:Do not breathe gas/fumes/vapor/spray (appropriate wording to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Safety Data | |
 |
|
