| Identification | |
| Name: | 1,2-Benzenedicarboxylicacid, 3-fluoro- |
| Synonyms: | Phthalicacid, 3-fluoro- (7CI,8CI);NSC 402999; |
| CAS: | 1583-67-1 |
| EINECS: | 216-433-5 |
| Molecular Formula: | C8H5FO4 |
| Molecular Weight: | 184.12 |
| InChI: | InChI=1/C8H5FO4/c9-4-1-2-5(7(10)11)6(3-4)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 181.9°C |
| Boiling Point: | 377.2°Cat760mmHg |
| Density: | 1.551g/cm3 |
| Appearance: | White to light yellow crystal powder |
| Specification: | White to light yellow crystal powder Safety Statements:26-37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 181.9°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
