Identification |
Name: | Benzoic acid,4-(pentyloxy)- |
Synonyms: | Benzoicacid, p-(pentyloxy)- (6CI,8CI);Benzoic acid, p-amoxy- (4CI);4-Pentoxybenzoicacid;NSC 71397;p-(Pentyloxy)benzoic acid;p-(n-Pentoxy)benzoic acid;p-Amyloxybenzoic acid;p-Pentoxybenzoic acid;p-n-Pentyloxybenzoic acid; |
CAS: | 15872-41-0 |
Molecular Formula: | C12H16O3 |
Molecular Weight: | 208.26 |
InChI: | InChI=1/C12H16O3/c1-2-3-4-9-15-11-7-5-10(6-8-11)12(13)14/h5-8H,2-4,9H2,1H3,(H,13,14) |
Molecular Structure: |
 |
Properties |
Flash Point: | 124.6°C |
Boiling Point: | 333.3°Cat760mmHg |
Density: | 1.084g/cm3 |
Water Solubility: | soluble in alcohol, aether and water |
Solubility: | soluble in alcohol, aether and water |
Appearance: | White to light yellow crystal powder |
Flash Point: | 124.6°C |
Usage: | Intermediates of Liquid Crystals |
Safety Data |
|
 |