Identification |
Name: | Benzene,4-bromo-1-isocyanato-2-methyl- |
Synonyms: | Isocyanicacid, 4-bromo-o-tolyl ester (7CI);4-Bromo-2-methylphenyl isocyanate; |
CAS: | 1591-98-6 |
Molecular Formula: | C8H6BrNO |
Molecular Weight: | 212.04 |
InChI: | InChI=1/C8H6BrNO/c1-6-4-7(9)2-3-8(6)10-5-11/h2-4H,1H3 |
Molecular Structure: |
|
Properties |
Transport: | 2811 |
Flash Point: | 107.9 ºC |
Boiling Point: | 254.7 ºCat 760 mmHg |
Density: | 1.44 g/cm3 |
Refractive index: | 1.571 |
Specification: | Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Packinggroup: | III |
Flash Point: | 107.9 ºC |
Sensitive: | Moisture Sensitive |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|