| Identification | |
| Name: | Phenol,2-cyclohexyl-4-methyl- |
| Synonyms: | p-Cresol,2-cyclohexyl- (6CI,7CI,8CI); 2-Cyclohexyl-4-methylphenol;2-Cyclohexyl-p-cresol; 4-Methyl-2-cyclohexylphenol; o-Cyclohexyl-p-cresol |
| CAS: | 1596-09-4 |
| EINECS: | 216-478-0 |
| Molecular Formula: | C13H18 O |
| Molecular Weight: | 190.31 |
| InChI: | InChI=1/C13H18O/c1-10-7-8-13(14)12(9-10)11-5-3-2-4-6-11/h7-9,11,14H,2-6H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 116.7°C |
| Boiling Point: | 257.1°Cat760mmHg |
| Density: | 1.026g/cm3 |
| Refractive index: | 1.547 |
| Specification: |
2-Cyclohexyl-4-methylphenol with CAS registry number of 1596-09-4 is also known as 2-Cyclohexyl-p-cresol ; Phenol, 2-cyclohexyl-4-methyl- . |
| Flash Point: | 116.7°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
