| Identification | |
| Name: | 2-(2-Methoxyethoxy)acetic acid |
| Synonyms: | Aceticacid, (2-methoxyethoxy)- (8CI,9CI);(2-Methoxyethoxy)acetic acid;3,6-Dioxaheptanoic acid; |
| CAS: | 16024-56-9 |
| EINECS: | 240-161-6 |
| Molecular Formula: | C5H10O4 |
| Molecular Weight: | 134.13 |
| InChI: | InChI=1/C5H10O4/c1-8-2-3-9-4-5(6)7/h2-4H2,1H3,(H,6,7) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3265 |
| Density: | 1.18 |
| Refractive index: | 1.436 |
| Appearance: | Colorless Or Straw yellow liquid |
| Specification: |
2-(2-Methoxyethoxy)acetic acid , with CAS number of 16024-56-9, can be called 3,6-Dioxaheptanoic acid ; 2-(2-Methoxyethoxy)acetic acid ; (2-Methoxyethoxy)acetic acid ; 2-(2-Methoxyethoxy)acetic acid, tech ; 2-(2-Methoxyethoxy)acetic ; O-(2-Methoxyethyl)glycolic acid ; (2-Methoxyethoxy)essigsure . |
| Packinggroup: | II |
| Safety Data | |
| Hazard Symbols |
C:Corrosive
|
 |
|
